CAS 100133-14-0
:2-(4-(DIMETHYLAMINO)PHENYL)ACETOHYDRAZIDE
Description:
2-(4-(Dimethylamino)phenyl)acetohydrazide, with the CAS number 100133-14-0, is an organic compound characterized by its hydrazide functional group and a dimethylamino substituent on a phenyl ring. This compound typically appears as a solid and is soluble in polar organic solvents due to the presence of the hydrazide moiety, which can engage in hydrogen bonding. The dimethylamino group contributes to its basicity and can influence its reactivity, making it a potential candidate for various chemical reactions, including those involving nucleophilic substitution. The compound may exhibit biological activity, which has led to interest in its applications in pharmaceuticals or as a reagent in organic synthesis. Its stability and reactivity can be affected by environmental conditions such as pH and temperature. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Proper storage and disposal methods should be followed to mitigate any potential hazards.
Formula:C10H15N3O
InChI:InChI=1/C10H15N3O/c1-13(2)9-5-3-8(4-6-9)7-10(14)12-11/h3-6H,7,11H2,1-2H3,(H,12,14)
SMILES:CN(C)c1ccc(cc1)CC(=NN)O
Synonyms:- 2-(4-Dimethylamino-Phenyl)Acetic Acid Hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
