CAS 1001346-91-3

4-Amino-2-fluoro-5-methoxybenzoic acid

Description:

4-Amino-2-fluoro-5-methoxybenzoic acid is an aromatic compound characterized by the presence of an amino group, a fluorine atom, and a methoxy group attached to a benzoic acid framework. This compound features a carboxylic acid functional group, which contributes to its acidic properties. The amino group (-NH2) enhances its potential for hydrogen bonding, influencing its solubility in polar solvents. The methoxy group (-OCH3) is an electron-donating substituent, which can affect the compound's reactivity and stability. The fluorine atom introduces electronegativity, potentially impacting the compound's electronic properties and interactions with biological systems. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Overall, 4-Amino-2-fluoro-5-methoxybenzoic acid is a versatile compound with unique properties that warrant further investigation in various chemical and biological contexts.

Formula: C₈H₈FNO₃

InChI: InChI=1S/C8H8FNO3/c1-13-7-2-4(8(11)12)5(9)3-6(7)10/h2-3H,10H2,1H3,(H,11,12)

SMILES: COc1cc(c(cc1N)F)C(=O)O

Synonyms:

• 2-Fluoro-4-amino-5-methoxybenzoic acid
• 4-Amino-2-fluoro-5-methoxybenzoicacid
• Benzoic acid, 4-amino-2-fluoro-5-methoxy-

Benzoic acid, 4-amino-2-fluoro-5-methoxy-

CAS: 1001346-91-3

Formula: C₈H₈FNO₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 185.1524

Ref: IN-DA00011X

4-Amino-2-fluoro-5-methoxybenzoic acid

CAS: 1001346-91-3

4-Amino-2-fluoro-5-methoxybenzoic acid

Purity: 96%

Molecular weight: 185.15g/mol

Ref: 54-PC906454

4-Amino-2-fluoro-5-methoxybenzoic acid

CAS: 1001346-91-3

Formula: C₈H₈FNO₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 185.154

Ref: 10-F223506