CAS 1001354-56-8

1,1-Dimethylethyl N-[(3R)-1-methyl-3-piperidinyl]carbamate

Description:

1,1-Dimethylethyl N-[(3R)-1-methyl-3-piperidinyl]carbamate, with the CAS number 1001354-56-8, is a chemical compound characterized by its unique structure, which includes a carbamate functional group and a piperidine ring. This compound typically exhibits properties associated with both amines and carbamates, such as potential solubility in polar solvents and the ability to form hydrogen bonds. The presence of the dimethyl group contributes to its steric hindrance, which can influence its reactivity and interactions with biological targets. The piperidine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to mimic natural biological structures. Additionally, the stereochemistry indicated by the (3R) configuration may play a crucial role in the compound's biological activity and pharmacokinetics. Overall, this compound's characteristics make it of interest in various fields, including organic synthesis and drug development.

Formula: C₁₁H₂₂N₂O₂

InChI: InChI=1S/C11H22N2O2/c1-11(2,3)15-10(14)12-9-6-5-7-13(4)8-9/h9H,5-8H2,1-4H3,(H,12,14)/t9-/m1/s1

InChI key: InChIKey=RKSXBNIWPXOYBC-SECBINFHSA-N

SMILES: N(C(OC(C)(C)C)=O)[C@H]1CN(C)CCC1

Synonyms:

• tert-Butyl (R)-N-(1-methylpiperidin-3-yl)carbamate
• Carbamic acid, N-[(3R)-1-methyl-3-piperidinyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[(3R)-1-methyl-3-piperidinyl]carbamate

tert-Butyl N-[(3R)-1-methylpiperidin-3-yl]carbamate

CAS: 1001354-56-8

Formula: C₁₁H₂₂N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 214.3046

Ref: IN-DA01JK4M

Tert-butyl (R)-(1-methylpiperidin-3-yl)carbamate

CAS: 1001354-56-8

Tert-butyl (R)-(1-methylpiperidin-3-yl)carbamate

Purity: 95%

Molecular weight: 214.31g/mol

Ref: 54-OR1004565