
CAS 1001354-72-8
:3-Amino-4-octanol
Description:
3-Amino-4-octanol is an organic compound characterized by the presence of both an amino group (-NH2) and a hydroxyl group (-OH) within its structure, specifically located on a linear octane chain. This compound typically exhibits properties associated with both amines and alcohols, such as being polar and capable of forming hydrogen bonds, which can influence its solubility in water and other solvents. The amino group contributes to its basicity, while the hydroxyl group imparts hydrophilic characteristics. 3-Amino-4-octanol may be utilized in various applications, including as a building block in organic synthesis, in the production of surfactants, or as an intermediate in pharmaceuticals. Its reactivity can be attributed to the functional groups present, allowing for potential derivatization and modification. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential hazards associated with amines and alcohols.
Formula:C8H19NO
InChI:InChI=1S/C8H19NO/c1-3-5-6-8(10)7(9)4-2/h7-8,10H,3-6,9H2,1-2H3
InChI key:InChIKey=AHZILZSKKSPIKM-UHFFFAOYSA-N
SMILES:C(C(CC)N)(CCCC)O
Synonyms:- 4-Octanol, 3-amino-
- Corrguard EXT
- 3-Amino-4-octanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.