CAS 10014-55-8

5-(4-Chlorobutyl)-4-methylthiazole

Description:

5-(4-Chlorobutyl)-4-methylthiazole, with the CAS number 10014-55-8, is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a 4-chlorobutyl side chain, contributing to its unique chemical properties and potential biological activity. The presence of the chlorine atom enhances its reactivity and may influence its interaction with biological systems. The methyl group at the 4-position of the thiazole ring can affect the compound's steric and electronic properties, potentially impacting its solubility and stability. Generally, thiazole derivatives are known for their diverse applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The specific characteristics, such as melting point, boiling point, and solubility, can vary based on the compound's purity and the conditions under which it is studied. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₈H₁₂ClNS

InChI: InChI=1S/C8H12ClNS/c1-7-8(11-6-10-7)4-2-3-5-9/h6H,2-5H2,1H3

InChI key: InChIKey=PZJADZFYWFTPOR-UHFFFAOYSA-N

SMILES: C(CCCCl)C1=C(C)N=CS1

Synonyms:

• Thiazole, 5-(4-chlorobutyl)-4-methyl-
• 5-(4-Chlorobutyl)-4-methylthiazole