CymitQuimica logo

CAS 1001401-62-2

:

2-(2H-1,2,3-Triazol-2-yl)benzoic acid

Description:
2-(2H-1,2,3-Triazol-2-yl)benzoic acid, with the CAS number 1001401-62-2, is an organic compound characterized by the presence of a benzoic acid moiety and a 1,2,3-triazole ring. This compound features a triazole group, which is a five-membered heterocyclic ring containing three nitrogen atoms, contributing to its unique chemical properties. The benzoic acid part of the molecule provides acidic characteristics due to the carboxylic acid functional group (-COOH), which can participate in hydrogen bonding and influence solubility in polar solvents. The triazole ring can also engage in various interactions, making this compound potentially useful in medicinal chemistry and material science. Its structural features may allow for coordination with metal ions, enhancing its applicability in catalysis or as a ligand in coordination chemistry. Additionally, the compound may exhibit biological activity, making it of interest for pharmaceutical research. Overall, 2-(2H-1,2,3-Triazol-2-yl)benzoic acid is a versatile compound with significant potential in various chemical and biological applications.
Formula:C9H7N3O2
InChI:InChI=1S/C9H7N3O2/c13-9(14)7-3-1-2-4-8(7)12-10-5-6-11-12/h1-6H,(H,13,14)
InChI key:InChIKey=UTENUPFWBIFKPW-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC=C1)N2N=CC=N2
Synonyms:
  • Benzoic acid, 2-(2H-1,2,3-triazol-2-yl)-
  • 2-[1,2,3]Triazol-2-ylbenzoic acid
  • 2-(2H-1,2,3-Triazol-2-yl)benzoic acid
Found 5 products.