CAS 1001414-03-4

7-Iodo-5-(phenylsulfonyl)-5H-pyrrolo[2,3-b]pyrazine

Description:

7-Iodo-5-(phenylsulfonyl)-5H-pyrrolo[2,3-b]pyrazine is a heterocyclic compound characterized by its complex structure, which includes a pyrrolo[2,3-b]pyrazine core. This compound features an iodine atom at the 7-position and a phenylsulfonyl group at the 5-position, contributing to its unique chemical properties. The presence of the iodine atom can enhance the compound's reactivity, making it useful in various synthetic applications, including medicinal chemistry. The phenylsulfonyl group is known for its ability to participate in sulfonamide chemistry, which can influence the compound's biological activity. This substance may exhibit interesting pharmacological properties, potentially acting as a lead compound in drug development. Its solubility, stability, and reactivity can vary based on the solvent and conditions used, making it essential to consider these factors in practical applications. Overall, 7-Iodo-5-(phenylsulfonyl)-5H-pyrrolo[2,3-b]pyrazine represents a valuable compound in the field of organic synthesis and medicinal chemistry.

Formula: C₁₂H₈IN₃O₂S

InChI: InChI=1S/C12H8IN3O2S/c13-10-8-16(12-11(10)14-6-7-15-12)19(17,18)9-4-2-1-3-5-9/h1-8H

InChI key: InChIKey=LRMSOTQVIIGPAZ-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1C=2C(C(I)=C1)=NC=CN2)C3=CC=CC=C3

Synonyms:

• 5H-Pyrrolo[2,3-b]pyrazine, 7-iodo-5-(phenylsulfonyl)-
• 7-Iodo-5-(phenylsulfonyl)-5H-pyrrolo[2,3-b]pyrazine