CymitQuimica logo

CAS 100142-85-6

:

4-[(4,5-dimethylthiazol-2-yl)amino]benzoic acid

Description:
4-[(4,5-dimethylthiazol-2-yl)amino]benzoic acid, with the CAS number 100142-85-6, is a chemical compound that features a thiazole ring substituted with amino and carboxylic acid functional groups. This compound is characterized by its aromatic structure, which contributes to its stability and potential reactivity. The presence of the thiazole moiety imparts unique electronic properties, making it of interest in various biochemical applications, particularly in drug development and as a potential pharmaceutical agent. The amino group enhances its solubility in polar solvents, while the carboxylic acid group can participate in hydrogen bonding and ionic interactions, influencing its biological activity. Additionally, the dimethyl substitutions on the thiazole ring can affect the compound's lipophilicity and overall pharmacokinetic profile. Overall, this compound's structural features suggest potential utility in medicinal chemistry, particularly in the design of compounds targeting specific biological pathways.
Formula:C12H12N2O2S
InChI:InChI=1/C12H12N2O2S/c1-7-8(2)17-12(13-7)14-10-5-3-9(4-6-10)11(15)16/h3-6H,1-2H3,(H,13,14)(H,15,16)
SMILES:Cc1c(C)sc(n1)Nc1ccc(cc1)C(=O)O
Synonyms:
  • 4-[(4,5-Dimethyl-1,3-thiazol-2-yl)amino]benzoic acid
  • Benzoic acid, 4-[(4,5-dimethyl-2-thiazolyl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.