CAS 100144-91-0
:3,5-Diethyldihydro-2H-pyran-2,6(3H)-dione
Description:
3,5-Diethyldihydro-2H-pyran-2,6(3H)-dione, with the CAS number 100144-91-0, is a chemical compound characterized by its unique bicyclic structure, which includes a pyran ring and two carbonyl groups. This compound is part of the class of diketones and is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of ethyl groups at the 3 and 5 positions contributes to its hydrophobic nature, influencing its solubility and reactivity. The diketone functionality allows for various chemical transformations, including condensation and oxidation reactions. Additionally, the compound may exhibit interesting biological activities, although specific studies on its pharmacological properties may be limited. Its stability and reactivity can be affected by environmental conditions such as temperature and pH, making it important to handle it under controlled conditions in laboratory settings. Overall, 3,5-Diethyldihydro-2H-pyran-2,6(3H)-dione is a noteworthy compound in the realm of synthetic organic chemistry.
Formula:C9H14O3
InChI:InChI=1S/C9H14O3/c1-3-6-5-7(4-2)9(11)12-8(6)10/h6-7H,3-5H2,1-2H3
InChI key:InChIKey=PUMIRPCJLHGLOT-UHFFFAOYSA-N
SMILES:C(C)C1CC(CC)C(=O)OC1=O
Synonyms:- YLH 1120
- 2,4-Diethylglutaric anhydride
- 3,5-Diethyldihydro-2H-pyran-2,6(3H)-dione
- 2H-Pyran-2,6(3H)-dione, 3,5-diethyldihydro-
- Glutaric anhydride, 2,4-diethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
