CAS 1001499-99-5

Methyl 3-methyl-4-nitro-1H-pyrazole-1-propanoate

Description:

Methyl 3-methyl-4-nitro-1H-pyrazole-1-propanoate, identified by its CAS number 1001499-99-5, is a chemical compound that belongs to the class of pyrazole derivatives. It typically features a pyrazole ring substituted with a nitro group and a methyl group, along with a propanoate moiety. This compound is characterized by its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its biological activity. The presence of the nitro group often contributes to its reactivity and may influence its interaction with biological targets. Methyl esters, like the propanoate in this compound, are generally known for their solubility in organic solvents and can participate in various chemical reactions, such as esterification and hydrolysis. The specific properties, such as melting point, boiling point, and solubility, can vary based on the molecular structure and substituents. Overall, this compound exemplifies the diverse chemistry of pyrazole derivatives and their potential utility in synthetic and medicinal chemistry.

Formula: C₈H₁₁N₃O₄

InChI: InChI=1S/C8H11N3O4/c1-6-7(11(13)14)5-10(9-6)4-3-8(12)15-2/h5H,3-4H2,1-2H3

InChI key: InChIKey=RIZFXFZOWGKEFB-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=CN(CCC(OC)=O)N=C1C

Synonyms:

• Methyl 3-methyl-4-nitro-1H-pyrazole-1-propanoate
• 1H-Pyrazole-1-propanoic acid, 3-methyl-4-nitro-, methyl ester