CymitQuimica logo

CAS 1001500-01-1

:

1-[(3,5-Dimethyl-4-nitro-1H-pyrazol-1-yl)methyl]-1H-pyrazole-3-carboxylic acid hydrazide

Description:
1-[(3,5-Dimethyl-4-nitro-1H-pyrazol-1-yl)methyl]-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its complex structure, which includes multiple functional groups such as a hydrazide and pyrazole moieties. The presence of the nitro group contributes to its potential reactivity and biological activity. This compound is likely to exhibit properties typical of hydrazides, including the ability to form hydrogen bonds and participate in various chemical reactions, such as condensation and oxidation. Its pyrazole framework may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can be influenced by the substituents on the pyrazole ring, particularly the dimethyl and nitro groups. Additionally, the presence of the carboxylic acid functional group suggests potential for acid-base reactions and interactions with biological targets. Overall, this compound's unique structural features may render it useful in various applications, including pharmaceuticals and agrochemicals, although specific biological activities would require further investigation.
Formula:C10H13N7O3
InChI:InChI=1S/C10H13N7O3/c1-6-9(17(19)20)7(2)16(13-6)5-15-4-3-8(14-15)10(18)12-11/h3-4H,5,11H2,1-2H3,(H,12,18)
InChI key:InChIKey=YOJLHFBCWOAFRX-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C)N(CN2N=C(C(NN)=O)C=C2)N=C1C
Synonyms:
  • 1-[(3,5-Dimethyl-4-nitro-1H-pyrazol-1-yl)methyl]-1H-pyrazole-3-carboxylic acid hydrazide
  • 1H-Pyrazole-3-carboxylic acid, 1-[(3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)methyl]-, hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.