CAS 1001500-02-2

2-[(3,5-Dimethyl-4-nitro-1H-pyrazol-1-yl)methyl]benzoic acid hydrazide

Description:

2-[(3,5-Dimethyl-4-nitro-1H-pyrazol-1-yl)methyl]benzoic acid hydrazide is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety linked to a hydrazide functional group. The presence of a 3,5-dimethyl-4-nitro-1H-pyrazole substituent contributes to its unique properties, potentially influencing its reactivity and biological activity. This compound may exhibit various functional characteristics, such as solubility in organic solvents and moderate stability under standard conditions. Its hydrazide group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the known bioactivity of hydrazides. The nitro group may also impart specific electronic properties, affecting the compound's interaction with biological targets. Overall, this substance's structural features indicate potential utility in research and development, particularly in fields related to drug discovery and material science. However, specific safety and handling guidelines should be followed due to the presence of nitro and hydrazide functionalities, which can pose risks in certain contexts.

Formula: C₁₃H₁₅N₅O₃

InChI: InChI=1S/C13H15N5O3/c1-8-12(18(20)21)9(2)17(16-8)7-10-5-3-4-6-11(10)13(19)15-14/h3-6H,7,14H2,1-2H3,(H,15,19)

InChI key: InChIKey=VGEBHXLPQDDNTN-UHFFFAOYSA-N

SMILES: C(N1C(C)=C(N(=O)=O)C(C)=N1)C2=C(C(NN)=O)C=CC=C2

Synonyms:

• Benzoic acid, 2-[(3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)methyl]-, hydrazide
• 2-[(3,5-Dimethyl-4-nitro-1H-pyrazol-1-yl)methyl]benzoic acid hydrazide