CAS 1001500-03-3
:3-(Dimethylamino)-1-(1-ethyl-3-methyl-1H-pyrazol-4-yl)-2-propen-1-one
Description:
3-(Dimethylamino)-1-(1-ethyl-3-methyl-1H-pyrazol-4-yl)-2-propen-1-one, identified by its CAS number 1001500-03-3, is an organic compound characterized by its complex structure that includes a dimethylamino group and a pyrazole moiety. This compound typically exhibits properties associated with both ketones and amines, which may influence its reactivity and solubility in various solvents. The presence of the propenone functional group suggests potential for electrophilic reactions, making it a candidate for various synthetic applications in organic chemistry. Additionally, the pyrazole ring may impart biological activity, as many pyrazole derivatives are known for their pharmacological properties. The compound's molecular structure allows for potential interactions with biological targets, which could be explored in medicinal chemistry. Overall, this substance is of interest for its synthetic versatility and potential applications in drug development and other chemical processes.
Formula:C11H17N3O
InChI:InChI=1S/C11H17N3O/c1-5-14-8-10(9(2)12-14)11(15)6-7-13(3)4/h6-8H,5H2,1-4H3
InChI key:InChIKey=XJIUOXZLQFETNG-UHFFFAOYSA-N
SMILES:C(C=CN(C)C)(=O)C1=CN(CC)N=C1C
Synonyms:- 3-(Dimethylamino)-1-(1-ethyl-3-methyl-1H-pyrazol-4-yl)-2-propen-1-one
- 2-Propen-1-one, 3-(dimethylamino)-1-(1-ethyl-3-methyl-1H-pyrazol-4-yl)-
Sort by
Found 0 products.