CAS 1001500-06-6

4-Chloro-1-[(2-fluorophenyl)methyl]-3-nitro-1H-pyrazole

Description:

4-Chloro-1-[(2-fluorophenyl)methyl]-3-nitro-1H-pyrazole is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a chloro group at the 4-position and a nitro group at the 3-position contributes to its reactivity and potential biological activity. The compound also features a 2-fluorophenylmethyl substituent, which enhances its lipophilicity and may influence its interaction with biological targets. This compound is typically synthesized through multi-step organic reactions, and its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of halogen and nitro functional groups often indicates that the compound may exhibit interesting pharmacological properties, including anti-inflammatory or antimicrobial activities. However, specific biological activities would require empirical investigation. As with many synthetic organic compounds, safety and handling precautions should be observed due to potential toxicity or environmental impact.

Formula: C₁₀H₇ClFN₃O₂

InChI: InChI=1S/C10H7ClFN3O2/c11-8-6-14(13-10(8)15(16)17)5-7-3-1-2-4-9(7)12/h1-4,6H,5H2

InChI key: InChIKey=TWFAPXHLBPIXPJ-UHFFFAOYSA-N

SMILES: C(N1N=C(N(=O)=O)C(Cl)=C1)C2=C(F)C=CC=C2

Synonyms:

• 1H-Pyrazole, 4-chloro-1-[(2-fluorophenyl)methyl]-3-nitro-
• 4-Chloro-1-[(2-fluorophenyl)methyl]-3-nitro-1H-pyrazole

4-Chloro-1-(2-fluorobenzyl)-3-nitro-1H-pyrazole

CAS: 1001500-06-6

4-Chloro-1-(2-fluorobenzyl)-3-nitro-1H-pyrazole

Purity: ≥95%

Molecular weight: 255.63g/mol

Ref: 54-PC410259