CAS 1001500-09-9
:4-Cyclopropyl-2,4-dihydro-5-[(5-methyl-1H-pyrazol-1-yl)methyl]-3H-1,2,4-triazole-3-thione
Description:
4-Cyclopropyl-2,4-dihydro-5-[(5-methyl-1H-pyrazol-1-yl)methyl]-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique triazole and thione functional groups, which contribute to its potential biological activity. The presence of a cyclopropyl group enhances its structural diversity, while the 5-methyl-1H-pyrazole moiety may influence its pharmacological properties. This compound is likely to exhibit properties typical of thiazoles and triazoles, such as antimicrobial or antifungal activity, although specific biological activities would depend on further empirical studies. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a candidate for research in medicinal chemistry and agrochemicals. As with many synthetic organic compounds, safety and handling precautions should be observed, and its environmental impact should be assessed in any practical applications.
Formula:C10H13N5S
InChI:InChI=1S/C10H13N5S/c1-7-4-5-11-14(7)6-9-12-13-10(16)15(9)8-2-3-8/h4-5,8H,2-3,6H2,1H3,(H,13,16)
InChI key:InChIKey=RFPCPVALSXMPRU-UHFFFAOYSA-N
SMILES:C(C=1N(C(=S)NN1)C2CC2)N3C(C)=CC=N3
Synonyms:- 3H-1,2,4-Triazole-3-thione, 4-cyclopropyl-2,4-dihydro-5-[(5-methyl-1H-pyrazol-1-yl)methyl]-
- 4-Cyclopropyl-2,4-dihydro-5-[(5-methyl-1H-pyrazol-1-yl)methyl]-3H-1,2,4-triazole-3-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.