CAS 1001500-12-4

2-Chloro-N-[4-chloro-1-(phenylmethyl)-1H-pyrazol-3-yl]acetamide

Description:

2-Chloro-N-[4-chloro-1-(phenylmethyl)-1H-pyrazol-3-yl]acetamide is a chemical compound characterized by its complex structure, which includes a chloroacetamide moiety and a substituted pyrazole ring. The presence of chlorine atoms in the structure contributes to its reactivity and potential biological activity. This compound is typically classified as an organic halide and may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, depending on the specific functional groups present. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyrazole ring, which is often associated with various biological activities. Additionally, the compound may undergo typical reactions of amides and halides, such as nucleophilic substitutions. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental concerns. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₁₂H₁₁Cl₂N₃O

InChI: InChI=1S/C12H11Cl2N3O/c13-6-11(18)15-12-10(14)8-17(16-12)7-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H,15,16,18)

InChI key: InChIKey=ZTLJBBBTWQQBHC-UHFFFAOYSA-N

SMILES: C(N1N=C(NC(CCl)=O)C(Cl)=C1)C2=CC=CC=C2

Synonyms:

• Acetamide, 2-chloro-N-[4-chloro-1-(phenylmethyl)-1H-pyrazol-3-yl]-
• 2-Chloro-N-[4-chloro-1-(phenylmethyl)-1H-pyrazol-3-yl]acetamide