CymitQuimica logo

CAS 1001500-16-8

:

4-Amino-1-ethyl-N-propyl-1H-pyrazole-3-carboxamide

Description:
4-Amino-1-ethyl-N-propyl-1H-pyrazole-3-carboxamide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features an amino group and a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of ethyl and propyl substituents on the nitrogen atom enhances its lipophilicity, which may influence its pharmacokinetic properties. The compound is likely to exhibit polar characteristics due to the carboxamide group, which can engage in hydrogen bonding. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Additionally, the compound's unique arrangement of functional groups may confer specific reactivity and interaction profiles, making it of interest for further research in drug design and synthesis. As with any chemical substance, safety and handling precautions should be observed, and its properties should be evaluated in the context of its intended use.
Formula:C9H16N4O
InChI:InChI=1S/C9H16N4O/c1-3-5-11-9(14)8-7(10)6-13(4-2)12-8/h6H,3-5,10H2,1-2H3,(H,11,14)
InChI key:InChIKey=NLNVCAQADOFNLV-UHFFFAOYSA-N
SMILES:C(NCCC)(=O)C=1C(N)=CN(CC)N1
Synonyms:
  • 1H-Pyrazole-3-carboxamide, 4-amino-1-ethyl-N-propyl-
  • 4-Amino-1-ethyl-N-propyl-1H-pyrazole-3-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.