CAS 1001500-17-9
:3,5-Dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]-1H-pyrazol-4-amine
Description:
3,5-Dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]-1H-pyrazol-4-amine is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of the 3,5-dimethyl groups contributes to its hydrophobic character, while the trifluoromethyl group attached to the phenyl ring enhances its lipophilicity and may influence its biological activity. This compound is likely to exhibit interesting pharmacological properties due to the combination of its structural features, which can affect its interaction with biological targets. The amine functional group can participate in hydrogen bonding, potentially enhancing its solubility in polar solvents. Additionally, the trifluoromethyl group is known to increase metabolic stability and can modulate the electronic properties of the molecule. Overall, the unique combination of substituents in this compound suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific biological activities and applications would require further investigation through experimental studies.
Formula:C13H14F3N3
InChI:InChI=1S/C13H14F3N3/c1-8-12(17)9(2)19(18-8)7-10-4-3-5-11(6-10)13(14,15)16/h3-6H,7,17H2,1-2H3
InChI key:InChIKey=FDRJWMIHMGQACQ-UHFFFAOYSA-N
SMILES:C(N1C(C)=C(N)C(C)=N1)C2=CC(C(F)(F)F)=CC=C2
Synonyms:- 1H-Pyrazol-4-amine, 3,5-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]-
- 3,5-Dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]-1H-pyrazol-4-amine
- 3,5-Dimethyl-1-[3-(trifluoromethyl)benzyl]-1H-pyrazol-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.