CAS 1001500-20-4

Methyl 1-[(2,6-dichlorophenoxy)methyl]-1H-pyrazole-3-carboxylate

Description:

Methyl 1-[(2,6-dichlorophenoxy)methyl]-1H-pyrazole-3-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a methyl ester functional group, contributing to its solubility and reactivity. The presence of the 2,6-dichlorophenoxy group indicates that it has significant hydrophobic characteristics, which can influence its biological activity and interactions. This compound is often studied for its potential applications in agrochemicals, particularly as a herbicide or pesticide, due to its ability to inhibit specific biochemical pathways in plants. Its molecular structure suggests it may exhibit moderate to high stability under various environmental conditions, although specific stability data would depend on factors such as pH and temperature. Additionally, the presence of chlorine atoms typically enhances the compound's lipophilicity, which can affect its absorption and distribution in biological systems. Overall, this compound represents a class of chemicals that are of interest in both synthetic chemistry and agricultural applications.

Formula: C₁₂H₁₀Cl₂N₂O₃

InChI: InChI=1S/C12H10Cl2N2O3/c1-18-12(17)10-5-6-16(15-10)7-19-11-8(13)3-2-4-9(11)14/h2-6H,7H2,1H3

InChI key: InChIKey=VVGFAICMONAAOE-UHFFFAOYSA-N

SMILES: O(CN1N=C(C(OC)=O)C=C1)C2=C(Cl)C=CC=C2Cl

Synonyms:

• 1H-Pyrazole-3-carboxylic acid, 1-[(2,6-dichlorophenoxy)methyl]-, methyl ester
• Methyl 1-[(2,6-dichlorophenoxy)methyl]-1H-pyrazole-3-carboxylate