CymitQuimica logo

CAS 1001500-26-0

:

Methyl 1-[(4-fluorophenoxy)methyl]-1H-pyrazole-3-carboxylate

Description:
Methyl 1-[(4-fluorophenoxy)methyl]-1H-pyrazole-3-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl ester functional group, contributing to its solubility and reactivity. The presence of a 4-fluorophenoxy group enhances its biological activity and may influence its pharmacokinetic properties. Typically, compounds of this nature are investigated for their potential applications in medicinal chemistry, particularly as agrochemicals or pharmaceuticals, due to their ability to interact with biological targets. The molecular structure suggests that it may exhibit specific interactions with enzymes or receptors, making it a candidate for further research in drug development. Additionally, the fluorine atom can enhance lipophilicity and metabolic stability. Overall, Methyl 1-[(4-fluorophenoxy)methyl]-1H-pyrazole-3-carboxylate represents a class of compounds that are of interest for their potential therapeutic applications and their unique chemical properties.
Formula:C12H11FN2O3
InChI:InChI=1S/C12H11FN2O3/c1-17-12(16)11-6-7-15(14-11)8-18-10-4-2-9(13)3-5-10/h2-7H,8H2,1H3
InChI key:InChIKey=CJSACAPAUMMNLW-UHFFFAOYSA-N
SMILES:C(OC1=CC=C(F)C=C1)N2N=C(C(OC)=O)C=C2
Synonyms:
  • 1H-Pyrazole-3-carboxylic acid, 1-[(4-fluorophenoxy)methyl]-, methyl ester
  • Methyl 1-[(4-fluorophenoxy)methyl]-1H-pyrazole-3-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.