CAS 1001500-29-3

Methyl 1-[(2,3-dichlorophenoxy)methyl]-1H-pyrazole-3-carboxylate

Description:

Methyl 1-[(2,3-dichlorophenoxy)methyl]-1H-pyrazole-3-carboxylate, identified by its CAS number 1001500-29-3, is a chemical compound that belongs to the class of pyrazole derivatives. This substance typically exhibits characteristics such as being a solid at room temperature and possessing a relatively low solubility in water, while being more soluble in organic solvents. The presence of the dichlorophenoxy group contributes to its potential biological activity, often making it a candidate for agricultural applications, particularly as a herbicide or pesticide. The pyrazole ring structure is known for its diverse pharmacological properties, which may include anti-inflammatory and anti-cancer activities. Additionally, the ester functional group in the molecule can influence its reactivity and stability. Safety data should be consulted for handling and exposure guidelines, as compounds of this nature may pose environmental and health risks. Overall, this compound represents a significant area of interest in both synthetic chemistry and agrochemical research.

Formula: C₁₂H₁₀Cl₂N₂O₃

InChI: InChI=1S/C12H10Cl2N2O3/c1-18-12(17)9-5-6-16(15-9)7-19-10-4-2-3-8(13)11(10)14/h2-6H,7H2,1H3

InChI key: InChIKey=WDNXTVHDJQHPHW-UHFFFAOYSA-N

SMILES: C(OC1=C(Cl)C(Cl)=CC=C1)N2N=C(C(OC)=O)C=C2

Synonyms:

• 1H-Pyrazole-3-carboxylic acid, 1-[(2,3-dichlorophenoxy)methyl]-, methyl ester
• Methyl 1-[(2,3-dichlorophenoxy)methyl]-1H-pyrazole-3-carboxylate