CAS 1001500-30-6
:1-Ethyl-5-methyl-4-nitro-1H-pyrazole
Description:
1-Ethyl-5-methyl-4-nitro-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an ethyl group at the first position, a methyl group at the fifth position, and a nitro group at the fourth position of the pyrazole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the nitro group suggests that it may have potential applications in the synthesis of other chemical compounds or as a reagent in various chemical reactions. Additionally, the compound's structure may impart specific biological activities, making it of interest in pharmaceutical research. Safety data should be consulted for handling and storage, as nitro compounds can be sensitive to heat and shock. Overall, 1-Ethyl-5-methyl-4-nitro-1H-pyrazole is a compound of interest in both synthetic and medicinal chemistry.
Formula:C6H9N3O2
InChI:InChI=1S/C6H9N3O2/c1-3-8-5(2)6(4-7-8)9(10)11/h4H,3H2,1-2H3
InChI key:InChIKey=KSTMVJNKTKVOLS-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C)N(CC)N=C1
Synonyms:- 1-Ethyl-5-methyl-4-nitro-1H-pyrazole
- 1H-Pyrazole, 1-ethyl-5-methyl-4-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.