CAS 1001500-32-8

1-Ethyl-3-methyl-4-nitro-1H-pyrazole

Description:

1-Ethyl-3-methyl-4-nitro-1H-pyrazole is an organic compound characterized by its pyrazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features an ethyl group at the first position, a methyl group at the third position, and a nitro group at the fourth position of the pyrazole ring. The presence of the nitro group contributes to its potential reactivity and makes it a candidate for various chemical applications, including as an intermediate in organic synthesis or in the development of agrochemicals. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties, such as stability and reactivity, can be influenced by the substituents on the pyrazole ring. Additionally, the compound may possess biological activity, which could be of interest in pharmaceutical research. Safety data should be consulted for handling and usage, as nitro compounds can be sensitive to heat and shock.

Formula: C₆H₉N₃O₂

InChI: InChI=1S/C6H9N3O2/c1-3-8-4-6(9(10)11)5(2)7-8/h4H,3H2,1-2H3

InChI key: InChIKey=TYUHNNYPMAKLIQ-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C(C)=NN(CC)C1

Synonyms:

• 1H-Pyrazole, 1-ethyl-3-methyl-4-nitro-
• 1-Ethyl-3-methyl-4-nitro-1H-pyrazole