CAS 1001500-37-3
:4-Amino-1-methyl-N-(2-methylpropyl)-1H-pyrazole-5-carboxamide
Description:
4-Amino-1-methyl-N-(2-methylpropyl)-1H-pyrazole-5-carboxamide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features an amino group and a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of the methyl and isobutyl substituents enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The compound's molecular structure suggests it may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its CAS number, 1001500-37-3, allows for precise identification in chemical databases. As with many pyrazole derivatives, it may be investigated for applications in agriculture, pharmaceuticals, or as a building block in organic synthesis. However, specific biological activities, toxicity, and environmental impact would require further empirical studies to establish its safety and efficacy in practical applications.
Formula:C9H16N4O
InChI:InChI=1S/C9H16N4O/c1-6(2)4-11-9(14)8-7(10)5-12-13(8)3/h5-6H,4,10H2,1-3H3,(H,11,14)
InChI key:InChIKey=RXNQYCAMQYXMIE-UHFFFAOYSA-N
SMILES:C(NCC(C)C)(=O)C1=C(N)C=NN1C
Synonyms:- 4-Amino-1-methyl-N-(2-methylpropyl)-1H-pyrazole-5-carboxamide
- 1H-Pyrazole-5-carboxamide, 4-amino-1-methyl-N-(2-methylpropyl)-
- 4-Amino-N-isobutyl-1-methyl-1H-pyrazole-5-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.