CAS 1001500-45-3
:4-Amino-N-(1,5-dimethyl-1H-pyrazol-4-yl)-1-ethyl-1H-pyrazole-5-carboxamide
Description:
4-Amino-N-(1,5-dimethyl-1H-pyrazol-4-yl)-1-ethyl-1H-pyrazole-5-carboxamide is a chemical compound characterized by its complex structure, which includes multiple functional groups such as amino, carboxamide, and pyrazole rings. This compound features a pyrazole core, which is a five-membered ring containing two nitrogen atoms, contributing to its potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding, enhancing its solubility in polar solvents. The dimethyl substitution on the pyrazole ring can influence its steric properties and reactivity. Additionally, the ethyl group attached to the pyrazole enhances its lipophilicity, potentially affecting its pharmacokinetic properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific interactions and applications would depend on further studies, including its synthesis, stability, and biological assays. As with many pyrazole derivatives, it may also be investigated for its potential as a therapeutic agent in various diseases.
Formula:C11H16N6O
InChI:InChI=1S/C11H16N6O/c1-4-17-10(8(12)5-14-17)11(18)15-9-6-13-16(3)7(9)2/h5-6H,4,12H2,1-3H3,(H,15,18)
InChI key:InChIKey=ZXRCOXHPWCRDFS-UHFFFAOYSA-N
SMILES:C(NC1=C(C)N(C)N=C1)(=O)C=2N(CC)N=CC2N
Synonyms:- 4-Amino-N-(1,5-dimethyl-1H-pyrazol-4-yl)-1-ethyl-1H-pyrazole-5-carboxamide
- 1H-Pyrazole-5-carboxamide, 4-amino-N-(1,5-dimethyl-1H-pyrazol-4-yl)-1-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.