
CAS 1001500-51-1
:4-Bromo-1-ethyl-N-methyl-1H-pyrazole-5-methanamine
Description:
4-Bromo-1-ethyl-N-methyl-1H-pyrazole-5-methanamine is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a bromine atom and an ethyl group, along with a methylated amine functional group. This compound typically exhibits properties associated with both heterocyclic compounds and amines, such as moderate solubility in polar solvents and potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The pyrazole ring contributes to its aromatic character, influencing its stability and reactivity. Additionally, the presence of the amine group may impart basic properties, allowing for interactions with acids and other electrophiles. This compound may find applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values.
Formula:C7H12BrN3
InChI:InChI=1S/C7H12BrN3/c1-3-11-7(5-9-2)6(8)4-10-11/h4,9H,3,5H2,1-2H3
InChI key:InChIKey=GSBLMXCODQJMJH-UHFFFAOYSA-N
SMILES:C(NC)C=1N(CC)N=CC1Br
Synonyms:- 4-Bromo-1-ethyl-N-methyl-1H-pyrazole-5-methanamine
- 1H-Pyrazole-5-methanamine, 4-bromo-1-ethyl-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.