CymitQuimica logo

CAS 1001500-52-2

:

4-Bromo-N,1-dimethyl-1H-pyrazole-5-methanamine

Description:
4-Bromo-N,1-dimethyl-1H-pyrazole-5-methanamine is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of a bromine atom at the 4-position and a dimethylamino group at the 1-position contributes to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The methanamine group at the 5-position enhances its nucleophilicity, making it a versatile intermediate in organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine functional group. Its molecular structure suggests potential biological activity, which could be explored in medicinal chemistry. As with many brominated compounds, it may also exhibit specific environmental and safety considerations, necessitating careful handling and disposal. Overall, 4-Bromo-N,1-dimethyl-1H-pyrazole-5-methanamine represents a valuable compound for research and development in various chemical applications.
Formula:C6H10BrN3
InChI:InChI=1S/C6H10BrN3/c1-8-4-6-5(7)3-9-10(6)2/h3,8H,4H2,1-2H3
InChI key:InChIKey=ARLPRHAVUSVMMO-UHFFFAOYSA-N
SMILES:C(NC)C1=C(Br)C=NN1C
Synonyms:
  • 4-Bromo-N,1-dimethyl-1H-pyrazole-5-methanamine
  • 1H-Pyrazole-5-methanamine, 4-bromo-N,1-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.