CymitQuimica logo

CAS 1001500-60-2

:

4-Cyclopropyl-5-[[3-(difluoromethyl)-5-methyl-1H-pyrazol-1-yl]methyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:
4-Cyclopropyl-5-[[3-(difluoromethyl)-5-methyl-1H-pyrazol-1-yl]methyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione, identified by its CAS number 1001500-60-2, is a synthetic organic compound characterized by its complex molecular structure, which includes a triazole ring and a pyrazole moiety. This compound features a cyclopropyl group, contributing to its unique steric and electronic properties. The presence of a difluoromethyl group enhances its lipophilicity and may influence its biological activity. As a thione, it contains a sulfur atom double-bonded to a carbon atom, which can impart distinct reactivity patterns compared to its corresponding oxo derivatives. The compound's potential applications may lie in medicinal chemistry, particularly in the development of pharmaceuticals, due to its diverse functional groups that can interact with biological targets. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used, making it a subject of interest for further research in drug design and synthesis.
Formula:C11H13F2N5S
InChI:InChI=1S/C11H13F2N5S/c1-6-4-8(10(12)13)16-17(6)5-9-14-15-11(19)18(9)7-2-3-7/h4,7,10H,2-3,5H2,1H3,(H,15,19)
InChI key:InChIKey=XKHBRGUAGSEAQX-UHFFFAOYSA-N
SMILES:C(C=1N(C(=S)NN1)C2CC2)N3N=C(C(F)F)C=C3C
Synonyms:
  • 3H-1,2,4-Triazole-3-thione, 4-cyclopropyl-5-[[3-(difluoromethyl)-5-methyl-1H-pyrazol-1-yl]methyl]-2,4-dihydro-
  • 4-Cyclopropyl-5-[[3-(difluoromethyl)-5-methyl-1H-pyrazol-1-yl]methyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.