CAS 1001500-65-7
:1-[(2,3-Dichlorophenoxy)methyl]-4-nitro-1H-pyrazole
Description:
1-[(2,3-Dichlorophenoxy)methyl]-4-nitro-1H-pyrazole, identified by its CAS number 1001500-65-7, is a chemical compound that features a pyrazole ring substituted with a nitro group and a dichlorophenoxy methyl group. This compound typically exhibits characteristics common to pyrazole derivatives, such as potential biological activity, which may include herbicidal or fungicidal properties. The presence of the nitro group can enhance its reactivity and influence its electronic properties, while the dichlorophenoxy moiety may contribute to its lipophilicity and ability to interact with biological targets. The compound is likely to be solid at room temperature and may have moderate solubility in organic solvents. Its synthesis and applications are of interest in agricultural chemistry, particularly in the development of new agrochemicals. Safety and handling precautions are essential due to the potential toxicity associated with halogenated compounds and nitro groups. As with any chemical, thorough evaluation of its environmental impact and regulatory status is crucial for its use.
Formula:C10H7Cl2N3O3
InChI:InChI=1S/C10H7Cl2N3O3/c11-8-2-1-3-9(10(8)12)18-6-14-5-7(4-13-14)15(16)17/h1-5H,6H2
InChI key:InChIKey=BEVAVDAOZSUWEF-UHFFFAOYSA-N
SMILES:C(OC1=C(Cl)C(Cl)=CC=C1)N2C=C(N(=O)=O)C=N2
Synonyms:- 1H-Pyrazole, 1-[(2,3-dichlorophenoxy)methyl]-4-nitro-
- 1-[(2,3-Dichlorophenoxy)methyl]-4-nitro-1H-pyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.