CAS 1001500-79-3
:Ethyl 3-methoxy-4-nitro-1H-pyrazole-1-propanoate
Description:
Ethyl 3-methoxy-4-nitro-1H-pyrazole-1-propanoate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a nitro group and a methoxy group, which contribute to its chemical reactivity and polarity. The ethyl ester functional group enhances its solubility in organic solvents, making it useful in various chemical applications. The presence of the nitro group typically imparts electrophilic characteristics, allowing for potential reactions with nucleophiles. Additionally, the methoxy group can influence the compound's electronic properties and steric hindrance. Ethyl 3-methoxy-4-nitro-1H-pyrazole-1-propanoate may be of interest in medicinal chemistry and agrochemical research due to its potential biological activities. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, this compound exemplifies the diverse functionalities that can be achieved through careful molecular design.
Formula:C9H13N3O5
InChI:InChI=1S/C9H13N3O5/c1-3-17-8(13)4-5-11-6-7(12(14)15)9(10-11)16-2/h6H,3-5H2,1-2H3
InChI key:InChIKey=KAJICRPGNPRJSH-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C(OC)=NN(CCC(OCC)=O)C1
Synonyms:- 1H-Pyrazole-1-propanoic acid, 3-methoxy-4-nitro-, ethyl ester
- Ethyl 3-methoxy-4-nitro-1H-pyrazole-1-propanoate
- 3-(3-METHOXY-4-NITRO-PYRAZOL-1-YL)-PROPIONIC ACID ETHYL ESTER
- Ethyl 3-(3-methoxy-4-nitro-1H-pyrazol-1-yl)propanoate
- AKOS B020588
- ART-CHEM-BB B020588
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery