CAS 1001500-83-9
:3-(Dimethylamino)-1-(1-methyl-4-nitro-1H-pyrazol-3-yl)-2-propen-1-one
Description:
3-(Dimethylamino)-1-(1-methyl-4-nitro-1H-pyrazol-3-yl)-2-propen-1-one, with the CAS number 1001500-83-9, is an organic compound characterized by its complex structure, which includes a dimethylamino group and a nitro-substituted pyrazole moiety. This compound typically exhibits properties associated with both its functional groups, such as potential reactivity due to the presence of the α,β-unsaturated carbonyl system. The dimethylamino group may impart basicity and influence solubility in polar solvents, while the nitro group can enhance electron-withdrawing characteristics, affecting the compound's reactivity in various chemical reactions. Additionally, the presence of the pyrazole ring suggests potential applications in medicinal chemistry, as pyrazole derivatives are often explored for their biological activities. Overall, this compound's unique structural features may contribute to its utility in synthetic organic chemistry and potential pharmacological applications, although specific biological activity and stability would require further investigation.
Formula:C9H12N4O3
InChI:InChI=1S/C9H12N4O3/c1-11(2)5-4-8(14)9-7(13(15)16)6-12(3)10-9/h4-6H,1-3H3
InChI key:InChIKey=FIITXULUDXDEBY-UHFFFAOYSA-N
SMILES:C(C=CN(C)C)(=O)C=1C(N(=O)=O)=CN(C)N1
Synonyms:- 3-(Dimethylamino)-1-(1-methyl-4-nitro-1H-pyrazol-3-yl)-2-propen-1-one
- 2-Propen-1-one, 3-(dimethylamino)-1-(1-methyl-4-nitro-1H-pyrazol-3-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.