CymitQuimica logo

CAS 1001500-85-1

:

Methyl 4-chloro-5-methyl-1H-pyrazole-1-propanoate

Description:
Methyl 4-chloro-5-methyl-1H-pyrazole-1-propanoate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a methyl group and a chloro substituent at specific positions on the pyrazole ring, contributing to its unique reactivity and properties. The propanoate moiety indicates the presence of an ester functional group, which can influence its solubility and volatility. Typically, compounds like this may exhibit biological activity, making them of interest in fields such as agrochemicals or pharmaceuticals. The presence of chlorine can enhance the compound's stability and lipophilicity, potentially affecting its interaction with biological systems. Additionally, the methyl groups may influence the steric hindrance and electronic properties of the molecule. Overall, Methyl 4-chloro-5-methyl-1H-pyrazole-1-propanoate is a versatile compound with potential applications in various chemical and biological contexts.
Formula:C8H11ClN2O2
InChI:InChI=1S/C8H11ClN2O2/c1-6-7(9)5-10-11(6)4-3-8(12)13-2/h5H,3-4H2,1-2H3
InChI key:InChIKey=CABGXDNDUUVBBW-UHFFFAOYSA-N
SMILES:C(CC(OC)=O)N1C(C)=C(Cl)C=N1
Synonyms:
  • 1H-Pyrazole-1-propanoic acid, 4-chloro-5-methyl-, methyl ester
  • Methyl 4-chloro-5-methyl-1H-pyrazole-1-propanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.