CAS 1001510-39-9
:1-[(2,6-Dichlorophenyl)methyl]-5-methyl-3-nitro-1H-pyrazole
Description:
1-[(2,6-Dichlorophenyl)methyl]-5-methyl-3-nitro-1H-pyrazole is a chemical compound characterized by its unique pyrazole structure, which includes a nitro group and a dichlorophenyl moiety. This compound typically exhibits a molecular formula that reflects its complex structure, incorporating elements such as carbon, hydrogen, nitrogen, and chlorine. The presence of the nitro group suggests potential reactivity and the ability to participate in various chemical reactions, including electrophilic substitutions. The dichlorophenyl group contributes to the compound's hydrophobic characteristics, which may influence its solubility in organic solvents. Additionally, the methyl group at the 5-position of the pyrazole ring can affect the compound's steric and electronic properties. This substance may have applications in pharmaceuticals or agrochemicals, given its structural features that could interact with biological systems. As with many pyrazole derivatives, it is essential to consider its safety, stability, and environmental impact when handling or utilizing this compound in research or industrial applications.
Formula:C11H9Cl2N3O2
InChI:InChI=1S/C11H9Cl2N3O2/c1-7-5-11(16(17)18)14-15(7)6-8-9(12)3-2-4-10(8)13/h2-5H,6H2,1H3
InChI key:InChIKey=ZCKROLPWLOOPLD-UHFFFAOYSA-N
SMILES:C(N1N=C(N(=O)=O)C=C1C)C2=C(Cl)C=CC=C2Cl
Synonyms:- 1-[(2,6-Dichlorophenyl)methyl]-5-methyl-3-nitro-1H-pyrazole
- 1H-Pyrazole, 1-[(2,6-dichlorophenyl)methyl]-5-methyl-3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.