CAS 1001518-93-9: 5-Cyclopropyl-3-(trifluoromethyl)-1H-pyrazole-1-acetic acid hydrazide
Description:5-Cyclopropyl-3-(trifluoromethyl)-1H-pyrazole-1-acetic acid hydrazide is a chemical compound characterized by its unique structural features, which include a pyrazole ring, a cyclopropyl group, and a trifluoromethyl substituent. The presence of the hydrazide functional group indicates that it contains a hydrazine moiety linked to an acetic acid derivative, which can influence its reactivity and biological activity. This compound is likely to exhibit polar characteristics due to the presence of the hydrazide and acetic acid functionalities, which may enhance its solubility in polar solvents. The trifluoromethyl group is known for imparting lipophilicity and can significantly affect the compound's pharmacokinetic properties. Additionally, the cyclopropyl group may contribute to the compound's conformational rigidity, potentially influencing its interaction with biological targets. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its diverse functional groups and potential bioactivity.
Formula:C9H11F3N4O
InChI:InChI=1S/C9H11F3N4O/c10-9(11,12)7-3-6(5-1-2-5)16(15-7)4-8(17)14-13/h3,5H,1-2,4,13H2,(H,14,17)
InChI key:InChIKey=KHAWEFXJUZDZDX-UHFFFAOYSA-N
SMILES:O=C(NN)CN1N=C(C=C1C2CC2)C(F)(F)F
- Synonyms:
- 1H-Pyrazole-1-acetic acid, 5-cyclopropyl-3-(trifluoromethyl)-, hydrazide
- 5-Cyclopropyl-3-(trifluoromethyl)-1H-pyrazole-1-acetic acid hydrazide
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-[5-Cyclopropyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]acetohydrazide REF: 54-PC410279CAS: 1001518-93-9 | - - - | 261.00 € | Tue 11 Mar 25 |
![]() | (5-Cyclopropyl-3-trifluoromethyl-pyrazol-1-yl)-acetic acid hydrazide REF: 10-F026756CAS: 1001518-93-9 | - - - | - - - | Discontinued product |
![]() | (5-Cyclopropyl-3-trifluoromethyl-pyrazol-1-yl)-acetic acid hydrazide REF: 3D-BQB51893CAS: 1001518-93-9 | Min. 95% | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
2-[5-Cyclopropyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]acetohydrazide
Ref: 54-PC410279
1g | 261.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
(5-Cyclopropyl-3-trifluoromethyl-pyrazol-1-yl)-acetic acid hydrazide
Ref: 10-F026756
1g | Discontinued | Request information | |
5g | Discontinued | Request information |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
(5-Cyclopropyl-3-trifluoromethyl-pyrazol-1-yl)-acetic acid hydrazide
Ref: 3D-BQB51893
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |