CAS 1001518-94-0

4-Chloro-5-cyclopropyl-3-(trifluoromethyl)-1H-pyrazole-1-acetic acid hydrazide

Description:

4-Chloro-5-cyclopropyl-3-(trifluoromethyl)-1H-pyrazole-1-acetic acid hydrazide is a chemical compound characterized by its unique structural features, including a pyrazole ring, a cyclopropyl group, and a trifluoromethyl substituent. The presence of the chloro group and the hydrazide functional group contributes to its reactivity and potential biological activity. This compound is typically used in research settings, particularly in medicinal chemistry, due to its potential as a pharmacological agent. Its hydrazide moiety may facilitate interactions with biological targets, making it of interest for developing new therapeutic agents. The trifluoromethyl group enhances lipophilicity and metabolic stability, which can influence the compound's pharmacokinetic properties. Additionally, the cyclopropyl group can impart unique steric and electronic characteristics, affecting the compound's overall behavior in biological systems. As with many pyrazole derivatives, this compound may exhibit a range of biological activities, including anti-inflammatory or anti-cancer properties, warranting further investigation into its mechanisms of action and therapeutic potential.

Formula: C₉H₁₀ClF₃N₄O

InChI: InChI=1S/C9H10ClF3N4O/c10-6-7(4-1-2-4)17(3-5(18)15-14)16-8(6)9(11,12)13/h4H,1-3,14H2,(H,15,18)

InChI key: InChIKey=DUHLWLNYIOTVQH-UHFFFAOYSA-N

SMILES: C(C(NN)=O)N1C(=C(Cl)C(C(F)(F)F)=N1)C2CC2

Synonyms:

• 1H-Pyrazole-1-acetic acid, 4-chloro-5-cyclopropyl-3-(trifluoromethyl)-, hydrazide
• 4-Chloro-5-cyclopropyl-3-(trifluoromethyl)-1H-pyrazole-1-acetic acid hydrazide
• 2-[4-Chloro-5-cyclopropyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]acetohydrazide

2-[4-Chloro-5-cyclopropyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]acetohydrazide

CAS: 1001518-94-0

2-[4-Chloro-5-cyclopropyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]acetohydrazide

Purity: ≥95%

Molecular weight: 282.65g/mol

Ref: 54-PC410280