CymitQuimica logo

CAS 1001519-14-7

:

Methyl 5-(1-ethyl-3-methyl-1H-pyrazol-4-yl)-3-isoxazolecarboxylate

Description:
Methyl 5-(1-ethyl-3-methyl-1H-pyrazol-4-yl)-3-isoxazolecarboxylate is a chemical compound characterized by its unique structural features, which include a pyrazole ring and an isoxazole moiety. This compound typically exhibits properties associated with both heterocyclic compounds and esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The pyrazole ring contributes to its biological activity, often making it of interest in medicinal chemistry for potential pharmacological applications. The isoxazole component may enhance its stability and influence its interaction with biological targets. Additionally, the presence of the methyl ester group suggests that it may undergo hydrolysis under certain conditions, leading to the corresponding carboxylic acid. Overall, this compound's characteristics, including its molecular structure and functional groups, position it as a candidate for further research in various fields, including drug development and agrochemicals.
Formula:C11H13N3O3
InChI:InChI=1S/C11H13N3O3/c1-4-14-6-8(7(2)12-14)10-5-9(13-17-10)11(15)16-3/h5-6H,4H2,1-3H3
InChI key:InChIKey=AKWZGWVVTNQAMB-UHFFFAOYSA-N
SMILES:CC=1C(=CN(CC)N1)C2=CC(C(OC)=O)=NO2
Synonyms:
  • 3-Isoxazolecarboxylic acid, 5-(1-ethyl-3-methyl-1H-pyrazol-4-yl)-, methyl ester
  • Methyl 5-(1-ethyl-3-methyl-1H-pyrazol-4-yl)-3-isoxazolecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.