
CAS 1001519-15-8
:Methyl 2-[[4-ethyl-5-(1-methyl-1H-pyrazol-5-yl)-4H-1,2,4-triazol-3-yl]thio]acetate
Description:
Methyl 2-[[4-ethyl-5-(1-methyl-1H-pyrazol-5-yl)-4H-1,2,4-triazol-3-yl]thio]acetate, with the CAS number 1001519-15-8, is a chemical compound characterized by its complex structure, which includes a methyl acetate group and a thioether linkage to a triazole derivative. This compound typically exhibits properties associated with both the ester and thiazole functionalities, such as moderate polarity and potential solubility in organic solvents. The presence of the pyrazole and triazole rings suggests potential biological activity, possibly as a fungicide or herbicide, given the common use of similar structures in agrochemical applications. Its molecular interactions may involve hydrogen bonding and dipole-dipole interactions due to the electronegative atoms in the rings. Additionally, the ethyl group can influence the lipophilicity of the molecule, affecting its bioavailability and reactivity. Overall, this compound's unique structural features contribute to its potential applications in various fields, including pharmaceuticals and agriculture.
Formula:C11H15N5O2S
InChI:InChI=1S/C11H15N5O2S/c1-4-16-10(8-5-6-12-15(8)2)13-14-11(16)19-7-9(17)18-3/h5-6H,4,7H2,1-3H3
InChI key:InChIKey=HALBRSSEZBWOQR-UHFFFAOYSA-N
SMILES:C(C)N1C(=NN=C1SCC(OC)=O)C=2N(C)N=CC2
Synonyms:- Methyl 2-[[4-ethyl-5-(1-methyl-1H-pyrazol-5-yl)-4H-1,2,4-triazol-3-yl]thio]acetate
- Acetic acid, 2-[[4-ethyl-5-(1-methyl-1H-pyrazol-5-yl)-4H-1,2,4-triazol-3-yl]thio]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.