CAS 1001519-27-2

4-Methoxy-3-[[5-methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]methyl]benzaldehyde

Description:

4-Methoxy-3-[[5-methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]methyl]benzaldehyde is an organic compound characterized by its complex structure, which includes a methoxy group, a benzaldehyde moiety, and a pyrazole ring with a trifluoromethyl substituent. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological targets. The trifluoromethyl group is known for imparting unique electronic properties, often enhancing lipophilicity and metabolic stability. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's stability and reactivity can be influenced by the presence of the aldehyde functional group, which is known for its ability to participate in various chemical reactions, including condensation and nucleophilic addition. Overall, this compound represents a fascinating example of modern organic synthesis with potential implications in drug discovery and development.

Formula: C₁₄H₁₃F₃N₂O₂

InChI: InChI=1S/C14H13F3N2O2/c1-9-5-13(14(15,16)17)18-19(9)7-11-6-10(8-20)3-4-12(11)21-2/h3-6,8H,7H2,1-2H3

InChI key: InChIKey=IEVOUVPXVZWHOE-UHFFFAOYSA-N

SMILES: C(C1=C(OC)C=CC(C=O)=C1)N2N=C(C(F)(F)F)C=C2C

Synonyms:

• 4-Methoxy-3-[[5-methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]methyl]benzaldehyde
• Benzaldehyde, 4-methoxy-3-[[5-methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]methyl]-

4-Methoxy-3-(5-methyl-3-trifluoromethyl-pyrazol-1-ylmethyl)-benzaldehyde

CAS: 1001519-27-2

Versatile small molecule scaffold

Formula: C₁₄H₁₃F₃N₂O₂

Purity: Min. 95%

Molecular weight: 298.26 g/mol

Ref: 3D-BQB51927