
CAS 1001519-29-4
:1-[(3-Methoxyphenyl)methyl]-3,5-dimethyl-1H-pyrazol-4-amine
Description:
1-[(3-Methoxyphenyl)methyl]-3,5-dimethyl-1H-pyrazol-4-amine is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a methoxy-substituted phenyl group attached to a methyl group, contributing to its overall hydrophobic character. The presence of the dimethyl groups at the 3 and 5 positions of the pyrazole ring enhances its steric bulk and may influence its biological activity. The amine functional group at the 4-position is indicative of potential reactivity and solubility in polar solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Additionally, the methoxy group can enhance lipophilicity, potentially affecting the compound's absorption and distribution in biological systems. Overall, this compound's unique structural features may contribute to its utility in various chemical and pharmaceutical applications.
Formula:C13H17N3O
InChI:InChI=1S/C13H17N3O/c1-9-13(14)10(2)16(15-9)8-11-5-4-6-12(7-11)17-3/h4-7H,8,14H2,1-3H3
InChI key:InChIKey=GPRGFWHPNSBRDW-UHFFFAOYSA-N
SMILES:C(N1C(C)=C(N)C(C)=N1)C2=CC(OC)=CC=C2
Synonyms:- 1-(3-Methoxybenzyl)-3,5-dimethyl-1H-pyrazol-4-amine
- 1H-Pyrazol-4-amine, 1-[(3-methoxyphenyl)methyl]-3,5-dimethyl-
- 1-[(3-Methoxyphenyl)methyl]-3,5-dimethyl-1H-pyrazol-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.