CAS 1001519-32-9
:4-(1,5-Dimethyl-1H-pyrazol-4-yl)-1,2-dihydro-2-thioxo-6-(trifluoromethyl)-3-pyridinecarbonitrile
Description:
4-(1,5-Dimethyl-1H-pyrazol-4-yl)-1,2-dihydro-2-thioxo-6-(trifluoromethyl)-3-pyridinecarbonitrile, with CAS number 1001519-32-9, is a chemical compound characterized by its complex structure, which includes a pyridine ring, a pyrazole moiety, and a thioxo group. This compound features a trifluoromethyl group, which is known for enhancing lipophilicity and biological activity. The presence of the cyano group (carbonitrile) contributes to its potential reactivity and applications in organic synthesis. The thioxo group may impart unique chemical properties, such as increased nucleophilicity. This compound is likely to exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its specific interactions and stability can be influenced by the presence of the trifluoromethyl and dimethyl groups, which may affect its solubility and reactivity in various solvents. Overall, this compound represents a class of heterocyclic compounds that are of interest in both synthetic and medicinal chemistry due to their diverse functional groups and potential applications.
Formula:C12H9F3N4S
InChI:InChI=1S/C12H9F3N4S/c1-6-9(5-17-19(6)2)7-3-10(12(13,14)15)18-11(20)8(7)4-16/h3,5H,1-2H3,(H,18,20)
InChI key:InChIKey=VSHSEVMTGLOVQR-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C=C(C(F)(F)F)NC1=S)C2=C(C)N(C)N=C2
Synonyms:- 4-(1,5-Dimethyl-1H-pyrazol-4-yl)-1,2-dihydro-2-thioxo-6-(trifluoromethyl)-3-pyridinecarbonitrile
- 3-Pyridinecarbonitrile, 4-(1,5-dimethyl-1H-pyrazol-4-yl)-1,2-dihydro-2-thioxo-6-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.