CAS 1001519-33-0: 4-(1-Ethyl-3-methyl-1H-pyrazol-4-yl)-1,2-dihydro-2-thioxo-6-(trifluoromethyl)-3-pyridinecarbonitrile

Description:4-(1-Ethyl-3-methyl-1H-pyrazol-4-yl)-1,2-dihydro-2-thioxo-6-(trifluoromethyl)-3-pyridinecarbonitrile is a complex organic compound characterized by its unique structural features, including a pyrazole ring and a pyridine moiety. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its biological activity. The thioxo group contributes to its reactivity, potentially allowing for interactions with various biological targets. This compound may exhibit properties such as antimicrobial, antifungal, or herbicidal activities, making it of interest in pharmaceutical and agricultural research. Its molecular structure suggests potential for diverse applications, particularly in the development of new therapeutic agents or agrochemicals. The compound's CAS number, 1001519-33-0, serves as a unique identifier, facilitating its identification in chemical databases and literature. As with many synthetic organic compounds, understanding its stability, solubility, and reactivity under different conditions is crucial for its practical applications. Further studies would be necessary to elucidate its full range of properties and potential uses.

Formula:C₁₃H₁₁F₃N₄S

InChI:InChI=1S/C13H11F3N4S/c1-3-20-6-10(7(2)19-20)8-4-11(13(14,15)16)18-12(21)9(8)5-17/h4,6H,3H2,1-2H3,(H,18,21)

InChI key:InChIKey=KFZCPZPVELIHNI-UHFFFAOYSA-N

SMILES:N#CC=1C(=S)NC(=CC1C2=CN(N=C2C)CC)C(F)(F)F

Synonyms:
4-(1-Ethyl-3-methyl-1H-pyrazol-4-yl)-1,2-dihydro-2-thioxo-6-(trifluoromethyl)-3-pyridinecarbonitrile
3-Pyridinecarbonitrile, 4-(1-ethyl-3-methyl-1H-pyrazol-4-yl)-1,2-dihydro-2-thioxo-6-(trifluoromethyl)-