CAS 1001519-35-2
:6-(Difluoromethyl)-4-(1,5-dimethyl-1H-pyrazol-4-yl)-1,2-dihydro-2-thioxo-3-pyridinecarbonitrile
Description:
6-(Difluoromethyl)-4-(1,5-dimethyl-1H-pyrazol-4-yl)-1,2-dihydro-2-thioxo-3-pyridinecarbonitrile is a chemical compound characterized by its complex structure, which includes a pyridine ring, a thioxo group, and a difluoromethyl substituent. The presence of the difluoromethyl group suggests potential applications in medicinal chemistry, as fluorinated compounds often exhibit enhanced biological activity and metabolic stability. The 1,5-dimethyl-1H-pyrazole moiety contributes to the compound's potential as a bioactive agent, possibly influencing its interaction with biological targets. The thioxo group may impart unique reactivity and stability characteristics, making it of interest in synthetic chemistry. This compound's carbonitrile functional group indicates potential for nucleophilic reactivity, which can be exploited in various chemical reactions. Overall, the unique combination of functional groups in this compound suggests it may have applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation through experimental studies.
Formula:C12H10F2N4S
InChI:InChI=1S/C12H10F2N4S/c1-6-9(5-16-18(6)2)7-3-10(11(13)14)17-12(19)8(7)4-15/h3,5,11H,1-2H3,(H,17,19)
InChI key:InChIKey=TVBTXDXTBAYPGN-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C=C(C(F)F)NC1=S)C2=C(C)N(C)N=C2
Synonyms:- 3-Pyridinecarbonitrile, 6-(difluoromethyl)-4-(1,5-dimethyl-1H-pyrazol-4-yl)-1,2-dihydro-2-thioxo-
- 6-(Difluoromethyl)-4-(1,5-dimethyl-1H-pyrazol-4-yl)-1,2-dihydro-2-thioxo-3-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.