CAS 1001567-68-5

1-(Difluoromethyl)-1H-pyrazole-3-carboxylic acid hydrazide

Description:

1-(Difluoromethyl)-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a difluoromethyl group and a hydrazide functional group. This compound typically exhibits properties associated with both pyrazole derivatives and hydrazides, such as potential biological activity, including antimicrobial or anti-inflammatory effects. The presence of the difluoromethyl group can enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. Additionally, the carboxylic acid moiety may contribute to its acidity and ability to form salts or complexes. The compound's hydrazide functionality suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific reactivity and stability can be influenced by environmental factors such as pH and temperature. Overall, 1-(Difluoromethyl)-1H-pyrazole-3-carboxylic acid hydrazide represents a versatile scaffold for further chemical modifications and investigations in various fields, including drug discovery and agrochemicals.

Formula: C₅H₆F₂N₄O

InChI: InChI=1S/C5H6F2N4O/c6-5(7)11-2-1-3(10-11)4(12)9-8/h1-2,5H,8H2,(H,9,12)

InChI key: InChIKey=ZSBPCYWVAJGMIS-UHFFFAOYSA-N

SMILES: C(NN)(=O)C1=NN(C(F)F)C=C1

Synonyms:

• 1H-Pyrazole-3-carboxylic acid, 1-(difluoromethyl)-, hydrazide
• 1-(Difluoromethyl)-1H-pyrazole-3-carbohydrazide
• 1-(Difluoromethyl)-1H-pyrazole-3-carboxylic acid hydrazide