CymitQuimica logo

CAS 100158-79-0

:

2-[(Diethylamino)methyl]-1-piperidineacetic acid

Description:
2-[(Diethylamino)methyl]-1-piperidineacetic acid, with the CAS number 100158-79-0, is a chemical compound characterized by its piperidine and diethylamino functional groups. This substance typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. It possesses both basic and acidic properties, which can influence its behavior in various chemical environments. The presence of the diethylamino group contributes to its basicity, while the carboxylic acid moiety imparts acidic characteristics. This compound is often studied for its potential applications in pharmaceuticals, particularly in the development of drugs targeting the central nervous system. Its structure allows for interactions with biological receptors, making it a candidate for further research in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H24N2O2
InChI:InChI=1S/C12H24N2O2/c1-3-13(4-2)9-11-7-5-6-8-14(11)10-12(15)16/h11H,3-10H2,1-2H3,(H,15,16)
InChI key:InChIKey=ZQTHSCUBLQNIBW-UHFFFAOYSA-N
SMILES:C(N(CC)CC)C1N(CC(O)=O)CCCC1
Synonyms:
  • 2-[2-(Diethylaminomethyl)piperidin-1-yl]acetic acid
  • 1-Piperidineacetic acid, 2-[(diethylamino)methyl]-
  • 2-[(Diethylamino)methyl]-1-piperidineacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.