CymitQuimica logo

CAS 10016-01-0

:

2-fluoro-N-methyl-N-(3-methylphenyl)acetamide

Description:
2-Fluoro-N-methyl-N-(3-methylphenyl)acetamide, with the CAS number 10016-01-0, is an organic compound characterized by its amide functional group, which features a fluorine atom and a methyl-substituted phenyl group. This compound typically exhibits a polar nature due to the presence of the amide bond, which can engage in hydrogen bonding, influencing its solubility in polar solvents. The fluorine atom contributes to the compound's unique reactivity and potential biological activity, as fluorinated compounds often exhibit altered pharmacokinetic properties. The presence of the 3-methylphenyl group adds steric bulk, which can affect the compound's interaction with biological targets. In terms of physical properties, it may have a moderate melting point and boiling point, typical of amides, and its molecular structure suggests it could be a solid at room temperature. Overall, 2-fluoro-N-methyl-N-(3-methylphenyl)acetamide is of interest in medicinal chemistry and material science due to its potential applications and unique chemical characteristics.
Formula:C10H12FNO
InChI:InChI=1/C10H12FNO/c1-8-4-3-5-9(6-8)12(2)10(13)7-11/h3-6H,7H2,1-2H3
SMILES:Cc1cccc(c1)N(C)C(=O)CF
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.