CAS 10016-12-3
:2-fluoro-N-(1-hydroxypropan-2-yl)-N-(naphthalen-1-yl)acetamide
Description:
2-Fluoro-N-(1-hydroxypropan-2-yl)-N-(naphthalen-1-yl)acetamide, with the CAS number 10016-12-3, is a chemical compound characterized by its unique structure that includes a fluorine atom, a hydroxypropan-2-yl group, and a naphthalenyl moiety. This compound typically exhibits properties associated with amides, such as moderate polarity and potential hydrogen bonding due to the presence of the hydroxyl group. The fluorine substitution can influence its reactivity and biological activity, often enhancing lipophilicity and altering pharmacokinetic properties. The naphthalene ring contributes to its aromatic character, which may affect its stability and interaction with biological targets. In terms of applications, compounds of this nature may be explored in medicinal chemistry for their potential therapeutic effects, particularly in areas related to neuropharmacology or as intermediates in organic synthesis. Overall, the specific characteristics of this compound, including its solubility, melting point, and reactivity, would depend on the precise conditions and environment in which it is studied.
Formula:C15H16FNO2
InChI:InChI=1/C15H16FNO2/c1-11(10-18)17(15(19)9-16)14-8-4-6-12-5-2-3-7-13(12)14/h2-8,11,18H,9-10H2,1H3
SMILES:CC(CO)N(c1cccc2ccccc12)C(=O)CF
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acetamide, 2-fluoro-N-(2-hydroxy-1-methylethyl)-N-1-naphthalenyl-
CAS:Formula:C15H16FNO2Molecular weight:261.2914
