CAS 10016-16-7

N-benzyl-2-fluoro-N-(naphthalen-2-yl)acetamide

Description:

N-benzyl-2-fluoro-N-(naphthalen-2-yl)acetamide, with the CAS number 10016-16-7, is an organic compound characterized by its unique structure, which includes a benzyl group, a fluoro substituent, and a naphthalene moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in organic solvents and potential for hydrogen bonding due to the presence of the amide functional group. The fluorine atom introduces electronegativity, which can influence the compound's reactivity and polarity. Additionally, the naphthalene ring contributes to the compound's aromatic character, potentially affecting its stability and interaction with other molecules. N-benzyl-2-fluoro-N-(naphthalen-2-yl)acetamide may be of interest in medicinal chemistry and material science due to its structural features, which could impart specific biological activities or physical properties. As with many organic compounds, its behavior in various chemical environments can be influenced by factors such as pH, temperature, and the presence of other reactive species.

Formula: C₁₉H₁₆FNO

InChI: InChI=1/C19H16FNO/c20-13-19(22)21(14-15-6-2-1-3-7-15)18-11-10-16-8-4-5-9-17(16)12-18/h1-12H,13-14H2

SMILES: c1ccc(cc1)CN(c1ccc2ccccc2c1)C(=O)CF

Acetamide, 2-fluoro-N-2-naphthalenyl-N-(phenylmethyl)-

CAS: 10016-16-7

Formula: C₁₉H₁₆FNO

Molecular weight: 293.3348

Ref: IN-DA00014D