
CAS 10016-32-7
:Carbonothioic acid
Description:
Carbonothioic acid, also known as thiocarbonic acid, is a chemical compound characterized by the presence of a carbon atom double-bonded to a sulfur atom and single-bonded to a hydroxyl group (–OH). Its molecular formula is typically represented as HCSO, indicating the presence of hydrogen, carbon, sulfur, and oxygen. This compound is known for its acidic properties, similar to other carboxylic acids, but with unique reactivity due to the sulfur atom. Carbonothioic acid can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it of interest in organic synthesis and materials science. It is generally unstable and can decompose under certain conditions, which limits its practical applications. Additionally, carbonothioic acid and its derivatives may exhibit biological activity, although detailed studies on its toxicity and environmental impact are limited. As with many sulfur-containing compounds, handling requires caution due to potential hazards associated with exposure.
Formula:CH2O2S
InChI:InChI=1S/CH2O2S/c2-1(3)4/h4H,(H,2,3)
InChI key:InChIKey=HDFRDWFLWVCOGP-UHFFFAOYSA-N
SMILES:C(=O)(O)S
Synonyms:- Carbonothioic acid
- Carbonic acid, thio-
- Thiocarbonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
