CAS 1001634-99-6

N-3-Isoxazolyl-2-methoxyacetamide

Description:

N-3-Isoxazolyl-2-methoxyacetamide is a chemical compound characterized by its isoxazole ring, which contributes to its unique reactivity and biological properties. The presence of the methoxy group enhances its solubility and may influence its interaction with biological targets. This compound typically exhibits moderate to high polarity due to the functional groups present, which can affect its pharmacokinetic properties, such as absorption and distribution in biological systems. It may also demonstrate specific biological activities, making it of interest in medicinal chemistry and drug development. The compound's structure suggests potential applications in various fields, including pharmaceuticals, where it could serve as a lead compound for further modifications aimed at enhancing efficacy or reducing toxicity. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including pH, temperature, and the presence of other reactive species. Safety data and handling precautions should be considered when working with this substance in a laboratory setting.

Formula: C₆H₈N₂O₃

InChI: InChI=1S/C6H8N2O3/c1-10-4-6(9)7-5-2-3-11-8-5/h2-3H,4H2,1H3,(H,7,8,9)

InChI key: InChIKey=NPEKALRYXREXCL-UHFFFAOYSA-N

SMILES: N(C(COC)=O)C=1C=CON1

Synonyms:

• N-3-Isoxazolyl-2-methoxyacetamide
• 2-Methoxy-N-(1,2-oxazol-3-yl)acetamide
• Acetamide, N-3-isoxazolyl-2-methoxy-
• N-(Isoxazol-3-yl)-2-methoxyacetamide