
CAS 1001646-85-0
:Methyl (αR)-1-[(1,1-dimethylethoxy)carbonyl]-α-[[(phenylmethoxy)carbonyl]amino]-4-piperidinebutanoate
Description:
Methyl (αR)-1-[(1,1-dimethylethoxy)carbonyl]-α-[[(phenylmethoxy)carbonyl]amino]-4-piperidinebutanoate, with CAS number 1001646-85-0, is a synthetic organic compound characterized by its complex structure, which includes a piperidine ring and multiple functional groups such as esters and amides. This compound typically exhibits properties associated with its molecular framework, including moderate solubility in organic solvents and potential bioactivity due to its amine and ester functionalities. The presence of the dimethylethoxycarbonyl group suggests it may have protective roles in synthetic pathways, while the phenylmethoxycarbonyl moiety could enhance its lipophilicity and influence its interaction with biological targets. As a piperidine derivative, it may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its stereochemistry, indicated by the αR configuration, can significantly affect its biological activity and interactions. Overall, this compound represents a class of molecules that may be explored for therapeutic applications, particularly in the development of pharmaceuticals.
Formula:C23H34N2O6
InChI:InChI=1S/C23H34N2O6/c1-23(2,3)31-22(28)25-14-12-17(13-15-25)10-11-19(20(26)29-4)24-21(27)30-16-18-8-6-5-7-9-18/h5-9,17,19H,10-16H2,1-4H3,(H,24,27)/t19-/m1/s1
InChI key:InChIKey=VJZVHJBSUUOYDL-LJQANCHMSA-N
SMILES:C(OC(C)(C)C)(=O)N1CCC(CC[C@@H](NC(OCC2=CC=CC=C2)=O)C(OC)=O)CC1
Synonyms:- 4-Piperidinebutanoic acid, 1-[(1,1-dimethylethoxy)carbonyl]-α-[[(phenylmethoxy)carbonyl]amino]-, methyl ester, (αR)-
- Methyl (αR)-1-[(1,1-dimethylethoxy)carbonyl]-α-[[(phenylmethoxy)carbonyl]amino]-4-piperidinebutanoate
Sort by
Found 0 products.